C16H21N5O4S3 — CID 46800339
1-[2-(diethylsulfamoyl)-4-nitroanilino]-3-(thiophen-2-ylmethyl)thiourea (PubChem CID 46800339) has the molecular formula C16H21N5O4S3 and a molecular weight of 443.58 g/mol. Its IUPAC name is 1-[2-(diethylsulfamoyl)-4-nitroanilino]-3-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 1-[2-(diethylsulfamoyl)-4-nitroanilino]-3-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 46800339 |
| Molecular Formula | C16H21N5O4S3 |
| Molecular Weight | 443.58 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | 1-[2-(diethylsulfamoyl)-4-nitroanilino]-3-(thiophen-2-ylmethyl)thiourea |
| SMILES | CCN(CC)S(=O)(=O)c1cc([N+](=O)[O-])ccc1NNC(=S)NCc1cccs1 |
| InChI | InChI=1S/C16H21N5O4S3/c1-3-20(4-2)28(24,25)15-10-12(21(22)23)7-8-14(15)18-19-16(26)17-11-13-6-5-9-27-13/h5-10,18H,3-4,11H2,1-2H3,(H2,17,19,26) |
| InChIKey | GUHQJFQAJIWIIH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.58 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|