C19H24ClN5O4S2 — CID 46632240
1-(2-chloro-4,6-dimethylphenyl)-3-[2-(diethylsulfamoyl)-4-nitroanilino]thiourea (PubChem CID 46632240) has the molecular formula C19H24ClN5O4S2 and a molecular weight of 486.02 g/mol. Its IUPAC name is 1-(2-chloro-4,6-dimethylphenyl)-3-[2-(diethylsulfamoyl)-4-nitroanilino]thiourea.
| Compound Name | 1-(2-chloro-4,6-dimethylphenyl)-3-[2-(diethylsulfamoyl)-4-nitroanilino]thiourea |
|---|---|
| PubChem CID | 46632240 |
| Molecular Formula | C19H24ClN5O4S2 |
| Molecular Weight | 486.02 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | 1-(2-chloro-4,6-dimethylphenyl)-3-[2-(diethylsulfamoyl)-4-nitroanilino]thiourea |
| SMILES | CCN(CC)S(=O)(=O)c1cc([N+](=O)[O-])ccc1NNC(=S)Nc1c(C)cc(C)cc1Cl |
| InChI | InChI=1S/C19H24ClN5O4S2/c1-5-24(6-2)31(28,29)17-11-14(25(26)27)7-8-16(17)22-23-19(30)21-18-13(4)9-12(3)10-15(18)20/h7-11,22H,5-6H2,1-4H3,(H2,21,23,30) |
| InChIKey | KXIBIKHWJVVPBZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.02 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_urea_D(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|