C17H21N5O4S2 — CID 5064281
1-[2-[(2,4-dimethylphenyl)sulfamoyl]-4-nitroanilino]-3-ethylthiourea (PubChem CID 5064281) has the molecular formula C17H21N5O4S2 and a molecular weight of 423.52 g/mol. Its IUPAC name is 1-[2-[(2,4-dimethylphenyl)sulfamoyl]-4-nitroanilino]-3-ethylthiourea.
| Compound Name | 1-[2-[(2,4-dimethylphenyl)sulfamoyl]-4-nitroanilino]-3-ethylthiourea |
|---|---|
| PubChem CID | 5064281 |
| Molecular Formula | C17H21N5O4S2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 1-[2-[(2,4-dimethylphenyl)sulfamoyl]-4-nitroanilino]-3-ethylthiourea |
| SMILES | CCNC(=S)NNc1ccc([N+](=O)[O-])cc1S(=O)(=O)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C17H21N5O4S2/c1-4-18-17(27)20-19-15-8-6-13(22(23)24)10-16(15)28(25,26)21-14-7-5-11(2)9-12(14)3/h5-10,19,21H,4H2,1-3H3,(H2,18,20,27) |
| InChIKey | WYNHYKSUACWYRV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|