C18H16ClN5O5S2 — CID 4831666
1-[2-[(4-chlorophenyl)sulfamoyl]-4-nitroanilino]-3-(furan-2-ylmethyl)thiourea (PubChem CID 4831666) has the molecular formula C18H16ClN5O5S2 and a molecular weight of 481.94 g/mol. Its IUPAC name is 1-[2-[(4-chlorophenyl)sulfamoyl]-4-nitroanilino]-3-(furan-2-ylmethyl)thiourea.
| Compound Name | 1-[2-[(4-chlorophenyl)sulfamoyl]-4-nitroanilino]-3-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 4831666 |
| Molecular Formula | C18H16ClN5O5S2 |
| Molecular Weight | 481.94 g/mol |
| Exact Mass | 481.03 |
| IUPAC Name | 1-[2-[(4-chlorophenyl)sulfamoyl]-4-nitroanilino]-3-(furan-2-ylmethyl)thiourea |
| SMILES | O=[N+]([O-])c1ccc(NNC(=S)NCc2ccco2)c(S(=O)(=O)Nc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C18H16ClN5O5S2/c19-12-3-5-13(6-4-12)23-31(27,28)17-10-14(24(25)26)7-8-16(17)21-22-18(30)20-11-15-2-1-9-29-15/h1-10,21,23H,11H2,(H2,20,22,30) |
| InChIKey | AXPVWXFPDUWRNF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 138.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.94 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|