C21H18ClN3O8S — CID 3882202
[1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 4-[(2-chloro-5-nitrophenyl)sulfonylamino]benzoate (PubChem CID 3882202) has the molecular formula C21H18ClN3O8S and a molecular weight of 507.91 g/mol. Its IUPAC name is [1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 4-[(2-chloro-5-nitrophenyl)sulfonylamino]benzoate.
| Compound Name | [1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 4-[(2-chloro-5-nitrophenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 3882202 |
| Molecular Formula | C21H18ClN3O8S |
| Molecular Weight | 507.91 g/mol |
| Exact Mass | 507.05 |
| IUPAC Name | [1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 4-[(2-chloro-5-nitrophenyl)sulfonylamino]benzoate |
| SMILES | CC(OC(=O)c1ccc(NS(=O)(=O)c2cc([N+](=O)[O-])ccc2Cl)cc1)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C21H18ClN3O8S/c1-13(20(26)23-12-17-3-2-10-32-17)33-21(27)14-4-6-15(7-5-14)24-34(30,31)19-11-16(25(28)29)8-9-18(19)22/h2-11,13,24H,12H2,1H3,(H,23,26) |
| InChIKey | RWHAWEWBFFUHKX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 157.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.91 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|