C18H21N5O7S2 — CID 3291928
2-[[2-[2-(3-methoxypropylcarbamothioyl)hydrazinyl]-5-nitrophenyl]sulfonylamino]benzoic acid (PubChem CID 3291928) has the molecular formula C18H21N5O7S2 and a molecular weight of 483.53 g/mol. Its IUPAC name is 2-[[2-[2-(3-methoxypropylcarbamothioyl)hydrazinyl]-5-nitrophenyl]sulfonylamino]benzoic acid.
| Compound Name | 2-[[2-[2-(3-methoxypropylcarbamothioyl)hydrazinyl]-5-nitrophenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 3291928 |
| Molecular Formula | C18H21N5O7S2 |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | 2-[[2-[2-(3-methoxypropylcarbamothioyl)hydrazinyl]-5-nitrophenyl]sulfonylamino]benzoic acid |
| SMILES | COCCCNC(=S)NNc1ccc([N+](=O)[O-])cc1S(=O)(=O)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C18H21N5O7S2/c1-30-10-4-9-19-18(31)21-20-15-8-7-12(23(26)27)11-16(15)32(28,29)22-14-6-3-2-5-13(14)17(24)25/h2-3,5-8,11,20,22H,4,9-10H2,1H3,(H,24,25)(H2,19,21,31) |
| InChIKey | AYSXHUWQLAPCMW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 171.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|