C18H15ClN4O5S — CID 5112356
N-(4-chlorophenyl)-2-[2-[1-(furan-2-yl)ethylidene]hydrazinyl]-5-nitrobenzenesulfonamide (PubChem CID 5112356) has the molecular formula C18H15ClN4O5S and a molecular weight of 434.86 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[2-[1-(furan-2-yl)ethylidene]hydrazinyl]-5-nitrobenzenesulfonamide.
| Compound Name | N-(4-chlorophenyl)-2-[2-[1-(furan-2-yl)ethylidene]hydrazinyl]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 5112356 |
| Molecular Formula | C18H15ClN4O5S |
| Molecular Weight | 434.86 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | N-(4-chlorophenyl)-2-[2-[1-(furan-2-yl)ethylidene]hydrazinyl]-5-nitrobenzenesulfonamide |
| SMILES | CC(=NNc1ccc([N+](=O)[O-])cc1S(=O)(=O)Nc1ccc(Cl)cc1)c1ccco1 |
| InChI | InChI=1S/C18H15ClN4O5S/c1-12(17-3-2-10-28-17)20-21-16-9-8-15(23(24)25)11-18(16)29(26,27)22-14-6-4-13(19)5-7-14/h2-11,21-22H,1H3 |
| InChIKey | QYFARPOBUNGVJJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.86 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|