C21H16ClN5O4S — CID 4166078
N-(4-chlorophenyl)-2-[2-[1-(4-cyanophenyl)ethylidene]hydrazinyl]-5-nitrobenzenesulfonamide (PubChem CID 4166078) has the molecular formula C21H16ClN5O4S and a molecular weight of 469.91 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[2-[1-(4-cyanophenyl)ethylidene]hydrazinyl]-5-nitrobenzenesulfonamide.
| Compound Name | N-(4-chlorophenyl)-2-[2-[1-(4-cyanophenyl)ethylidene]hydrazinyl]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 4166078 |
| Molecular Formula | C21H16ClN5O4S |
| Molecular Weight | 469.91 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | N-(4-chlorophenyl)-2-[2-[1-(4-cyanophenyl)ethylidene]hydrazinyl]-5-nitrobenzenesulfonamide |
| SMILES | CC(=NNc1ccc([N+](=O)[O-])cc1S(=O)(=O)Nc1ccc(Cl)cc1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C21H16ClN5O4S/c1-14(16-4-2-15(13-23)3-5-16)24-25-20-11-10-19(27(28)29)12-21(20)32(30,31)26-18-8-6-17(22)7-9-18/h2-12,25-26H,1H3 |
| InChIKey | AZFDODWUCQIHNF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 137.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.91 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|