C24H19ClN4O4S — CID 5144698
N-(4-chlorophenyl)-4-[2-(1-naphthalen-2-ylethylidene)hydrazinyl]-3-nitrobenzenesulfonamide (PubChem CID 5144698) has the molecular formula C24H19ClN4O4S and a molecular weight of 494.96 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[2-(1-naphthalen-2-ylethylidene)hydrazinyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-(4-chlorophenyl)-4-[2-(1-naphthalen-2-ylethylidene)hydrazinyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 5144698 |
| Molecular Formula | C24H19ClN4O4S |
| Molecular Weight | 494.96 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | N-(4-chlorophenyl)-4-[2-(1-naphthalen-2-ylethylidene)hydrazinyl]-3-nitrobenzenesulfonamide |
| SMILES | CC(=NNc1ccc(S(=O)(=O)Nc2ccc(Cl)cc2)cc1[N+](=O)[O-])c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H19ClN4O4S/c1-16(18-7-6-17-4-2-3-5-19(17)14-18)26-27-23-13-12-22(15-24(23)29(30)31)34(32,33)28-21-10-8-20(25)9-11-21/h2-15,27-28H,1H3 |
| InChIKey | LNBFQNBURSQSQD-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.96 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_naphth_A(5)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|