C21H20N2O6S2 — CID 26545606
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,3-dimethyl-5-nitro-N-(thiophen-2-ylmethyl)benzenesulfonamide (PubChem CID 26545606) has the molecular formula C21H20N2O6S2 and a molecular weight of 460.53 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,3-dimethyl-5-nitro-N-(thiophen-2-ylmethyl)benzenesulfonamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,3-dimethyl-5-nitro-N-(thiophen-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 26545606 |
| Molecular Formula | C21H20N2O6S2 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,3-dimethyl-5-nitro-N-(thiophen-2-ylmethyl)benzenesulfonamide |
| SMILES | Cc1cc([N+](=O)[O-])cc(S(=O)(=O)N(Cc2cccs2)c2ccc3c(c2)OCCO3)c1C |
| InChI | InChI=1S/C21H20N2O6S2/c1-14-10-17(23(24)25)12-21(15(14)2)31(26,27)22(13-18-4-3-9-30-18)16-5-6-19-20(11-16)29-8-7-28-19/h3-6,9-12H,7-8,13H2,1-2H3 |
| InChIKey | PGHNKOAJNPECPH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|