C22H23N3O6S2 — CID 143365438
1-[2-(methylamino)-5-[(2-nitrophenyl)sulfonyl-(thiophen-2-ylmethyl)amino]phenyl]propan-2-yl formate (PubChem CID 143365438) has the molecular formula C22H23N3O6S2 and a molecular weight of 489.58 g/mol. Its IUPAC name is 1-[2-(methylamino)-5-[(2-nitrophenyl)sulfonyl-(thiophen-2-ylmethyl)amino]phenyl]propan-2-yl formate.
| Compound Name | 1-[2-(methylamino)-5-[(2-nitrophenyl)sulfonyl-(thiophen-2-ylmethyl)amino]phenyl]propan-2-yl formate |
|---|---|
| PubChem CID | 143365438 |
| Molecular Formula | C22H23N3O6S2 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | 1-[2-(methylamino)-5-[(2-nitrophenyl)sulfonyl-(thiophen-2-ylmethyl)amino]phenyl]propan-2-yl formate |
| SMILES | CNc1ccc(N(Cc2cccs2)S(=O)(=O)c2ccccc2[N+](=O)[O-])cc1CC(C)OC=O |
| InChI | InChI=1S/C22H23N3O6S2/c1-16(31-15-26)12-17-13-18(9-10-20(17)23-2)24(14-19-6-5-11-32-19)33(29,30)22-8-4-3-7-21(22)25(27)28/h3-11,13,15-16,23H,12,14H2,1-2H3 |
| InChIKey | NDZSACYANCBPDP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|