C34H46N4O14S2 — CID 44518890
N-[(2S)-2-[2-(2-methoxyethoxy)ethoxy]propyl]-N-[3-[[(2S)-2-[2-(2-methoxyethoxy)ethoxy]propyl]-(2-nitrophenyl)sulfonylamino]phenyl]-2-nitrobenzenesulfonamide (PubChem CID 44518890) has the molecular formula C34H46N4O14S2 and a molecular weight of 798.89 g/mol. Its IUPAC name is N-[(2S)-2-[2-(2-methoxyethoxy)ethoxy]propyl]-N-[3-[[(2S)-2-[2-(2-methoxyethoxy)ethoxy]propyl]-(2-nitrophenyl)sulfonylamino]phenyl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[(2S)-2-[2-(2-methoxyethoxy)ethoxy]propyl]-N-[3-[[(2S)-2-[2-(2-methoxyethoxy)ethoxy]propyl]-(2-nitrophenyl)sulfonylamino]phenyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 44518890 |
| Molecular Formula | C34H46N4O14S2 |
| Molecular Weight | 798.89 g/mol |
| Exact Mass | 798.25 |
| IUPAC Name | N-[(2S)-2-[2-(2-methoxyethoxy)ethoxy]propyl]-N-[3-[[(2S)-2-[2-(2-methoxyethoxy)ethoxy]propyl]-(2-nitrophenyl)sulfonylamino]phenyl]-2-nitrobenzenesulfonamide |
| SMILES | COCCOCCO[C@@H](C)CN(c1cccc(N(C[C@H](C)OCCOCCOC)S(=O)(=O)c2ccccc2[N+](=O)[O-])c1)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C34H46N4O14S2/c1-27(51-22-20-49-18-16-47-3)25-35(53(43,44)33-14-7-5-12-31(33)37(39)40)29-10-9-11-30(24-29)36(26-28(2)52-23-21-50-19-17-48-4)54(45,46)34-15-8-6-13-32(34)38(41)42/h5-15,24,27-28H,16-23,25-26H2,1-4H3/t27-,28-/m0/s1 |
| InChIKey | RFUKDLJCPIRPQC-NSOVKSMOSA-N |
| XLogP | 4.03 |
| TPSA | 216.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.89 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|