C15H24N2O3S2 — CID 143365354
N-(4-methyl-2-sulfanylidene-4,5-dihydro-1H-3,1-benzoxazepin-7-yl)cyclopentanesulfonamide;molecular hydrogen (PubChem CID 143365354) has the molecular formula C15H24N2O3S2 and a molecular weight of 344.50 g/mol. Its IUPAC name is N-(4-methyl-2-sulfanylidene-4,5-dihydro-1H-3,1-benzoxazepin-7-yl)cyclopentanesulfonamide;molecular hydrogen.
| Compound Name | N-(4-methyl-2-sulfanylidene-4,5-dihydro-1H-3,1-benzoxazepin-7-yl)cyclopentanesulfonamide;molecular hydrogen |
|---|---|
| PubChem CID | 143365354 |
| Molecular Formula | C15H24N2O3S2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | N-(4-methyl-2-sulfanylidene-4,5-dihydro-1H-3,1-benzoxazepin-7-yl)cyclopentanesulfonamide;molecular hydrogen |
| SMILES | CC1Cc2cc(NS(=O)(=O)C3CCCC3)ccc2NC(=S)O1.[H][H].[H][H] |
| InChI | InChI=1S/C15H20N2O3S2.2H2/c1-10-8-11-9-12(6-7-14(11)16-15(21)20-10)17-22(18,19)13-4-2-3-5-13;;/h6-7,9-10,13,17H,2-5,8H2,1H3,(H,16,21);2*1H |
| InChIKey | IZFJJJPRAKSIJY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|