C16H18N2O3S3 — CID 11998368
N-(4,7,9-trimethyl-2-sulfanylidene-4,5-dihydro-1H-3,1-benzoxazepin-6-yl)thiophene-3-sulfonamide (PubChem CID 11998368) has the molecular formula C16H18N2O3S3 and a molecular weight of 382.53 g/mol. Its IUPAC name is N-(4,7,9-trimethyl-2-sulfanylidene-4,5-dihydro-1H-3,1-benzoxazepin-6-yl)thiophene-3-sulfonamide.
| Compound Name | N-(4,7,9-trimethyl-2-sulfanylidene-4,5-dihydro-1H-3,1-benzoxazepin-6-yl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 11998368 |
| Molecular Formula | C16H18N2O3S3 |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | N-(4,7,9-trimethyl-2-sulfanylidene-4,5-dihydro-1H-3,1-benzoxazepin-6-yl)thiophene-3-sulfonamide |
| SMILES | Cc1cc(C)c(NS(=O)(=O)c2ccsc2)c2c1NC(=S)OC(C)C2 |
| InChI | InChI=1S/C16H18N2O3S3/c1-9-6-10(2)15(18-24(19,20)12-4-5-23-8-12)13-7-11(3)21-16(22)17-14(9)13/h4-6,8,11,18H,7H2,1-3H3,(H,17,22) |
| InChIKey | SYHBWIYLTGLSLP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|