C19H22N2O4S3 — CID 143365307
N-(8-cyclopentyloxy-4-methyl-2-sulfanylidene-4,5-dihydro-1H-3,1-benzoxazepin-6-yl)thiophene-2-sulfonamide (PubChem CID 143365307) has the molecular formula C19H22N2O4S3 and a molecular weight of 438.60 g/mol. Its IUPAC name is N-(8-cyclopentyloxy-4-methyl-2-sulfanylidene-4,5-dihydro-1H-3,1-benzoxazepin-6-yl)thiophene-2-sulfonamide.
| Compound Name | N-(8-cyclopentyloxy-4-methyl-2-sulfanylidene-4,5-dihydro-1H-3,1-benzoxazepin-6-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 143365307 |
| Molecular Formula | C19H22N2O4S3 |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | N-(8-cyclopentyloxy-4-methyl-2-sulfanylidene-4,5-dihydro-1H-3,1-benzoxazepin-6-yl)thiophene-2-sulfonamide |
| SMILES | CC1Cc2c(cc(OC3CCCC3)cc2NS(=O)(=O)c2cccs2)NC(=S)O1 |
| InChI | InChI=1S/C19H22N2O4S3/c1-12-9-15-16(20-19(26)24-12)10-14(25-13-5-2-3-6-13)11-17(15)21-28(22,23)18-7-4-8-27-18/h4,7-8,10-13,21H,2-3,5-6,9H2,1H3,(H,20,26) |
| InChIKey | XMVDETDXFPKGDE-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|