C19H26ClN3O2S3 — CID 163241551
5-[3-chloro-2-[cyclohexyl(methyl)amino]anilino]sulfanyl-N,N-dimethylthiophene-2-sulfonamide (PubChem CID 163241551) has the molecular formula C19H26ClN3O2S3 and a molecular weight of 460.09 g/mol. Its IUPAC name is 5-[3-chloro-2-[cyclohexyl(methyl)amino]anilino]sulfanyl-N,N-dimethylthiophene-2-sulfonamide.
| Compound Name | 5-[3-chloro-2-[cyclohexyl(methyl)amino]anilino]sulfanyl-N,N-dimethylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 163241551 |
| Molecular Formula | C19H26ClN3O2S3 |
| Molecular Weight | 460.09 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | 5-[3-chloro-2-[cyclohexyl(methyl)amino]anilino]sulfanyl-N,N-dimethylthiophene-2-sulfonamide |
| SMILES | CN(c1c(Cl)cccc1NSc1ccc(S(=O)(=O)N(C)C)s1)C1CCCCC1 |
| InChI | InChI=1S/C19H26ClN3O2S3/c1-22(2)28(24,25)18-13-12-17(26-18)27-21-16-11-7-10-15(20)19(16)23(3)14-8-5-4-6-9-14/h7,10-14,21H,4-6,8-9H2,1-3H3 |
| InChIKey | FRKHUCUVVORCQN-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.09 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|