C20H28ClN3O3S3 — CID 163241487
5-[3-chloro-2-[2-(2-methoxyethyl)piperidin-1-yl]anilino]sulfanyl-N,N-dimethylthiophene-2-sulfonamide (PubChem CID 163241487) has the molecular formula C20H28ClN3O3S3 and a molecular weight of 490.12 g/mol. Its IUPAC name is 5-[3-chloro-2-[2-(2-methoxyethyl)piperidin-1-yl]anilino]sulfanyl-N,N-dimethylthiophene-2-sulfonamide.
| Compound Name | 5-[3-chloro-2-[2-(2-methoxyethyl)piperidin-1-yl]anilino]sulfanyl-N,N-dimethylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 163241487 |
| Molecular Formula | C20H28ClN3O3S3 |
| Molecular Weight | 490.12 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | 5-[3-chloro-2-[2-(2-methoxyethyl)piperidin-1-yl]anilino]sulfanyl-N,N-dimethylthiophene-2-sulfonamide |
| SMILES | COCCC1CCCCN1c1c(Cl)cccc1NSc1ccc(S(=O)(=O)N(C)C)s1 |
| InChI | InChI=1S/C20H28ClN3O3S3/c1-23(2)30(25,26)19-11-10-18(28-19)29-22-17-9-6-8-16(21)20(17)24-13-5-4-7-15(24)12-14-27-3/h6,8-11,15,22H,4-5,7,12-14H2,1-3H3 |
| InChIKey | ASKOLBLXBOSWJA-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.12 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|