C23H30ClN3O3S — CID 46448626
4-chloro-N-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]-3-(dimethylsulfamoyl)benzamide (PubChem CID 46448626) has the molecular formula C23H30ClN3O3S and a molecular weight of 464.03 g/mol. Its IUPAC name is 4-chloro-N-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]-3-(dimethylsulfamoyl)benzamide.
| Compound Name | 4-chloro-N-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]-3-(dimethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 46448626 |
| Molecular Formula | C23H30ClN3O3S |
| Molecular Weight | 464.03 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 4-chloro-N-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]-3-(dimethylsulfamoyl)benzamide |
| SMILES | CN(Cc1ccccc1NC(=O)c1ccc(Cl)c(S(=O)(=O)N(C)C)c1)C1CCCCC1 |
| InChI | InChI=1S/C23H30ClN3O3S/c1-26(2)31(29,30)22-15-17(13-14-20(22)24)23(28)25-21-12-8-7-9-18(21)16-27(3)19-10-5-4-6-11-19/h7-9,12-15,19H,4-6,10-11,16H2,1-3H3,(H,25,28) |
| InChIKey | OBMMPAOBDWIWKD-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.03 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |