C25H34ClN3O3S — CID 17452883
4-chloro-N-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]-3-(diethylsulfamoyl)benzamide (PubChem CID 17452883) has the molecular formula C25H34ClN3O3S and a molecular weight of 492.09 g/mol. Its IUPAC name is 4-chloro-N-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]-3-(diethylsulfamoyl)benzamide.
| Compound Name | 4-chloro-N-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]-3-(diethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 17452883 |
| Molecular Formula | C25H34ClN3O3S |
| Molecular Weight | 492.09 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | 4-chloro-N-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]-3-(diethylsulfamoyl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)Nc2ccccc2CN(C)C2CCCCC2)ccc1Cl |
| InChI | InChI=1S/C25H34ClN3O3S/c1-4-29(5-2)33(31,32)24-17-19(15-16-22(24)26)25(30)27-23-14-10-9-11-20(23)18-28(3)21-12-7-6-8-13-21/h9-11,14-17,21H,4-8,12-13,18H2,1-3H3,(H,27,30) |
| InChIKey | SAWKPYXMJZZDOF-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.09 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |