C22H27ClN2O4S — CID 52857530
methyl 3-chloro-4-[[2-[[cyclohexyl(methyl)amino]methyl]phenyl]sulfamoyl]benzoate (PubChem CID 52857530) has the molecular formula C22H27ClN2O4S and a molecular weight of 450.99 g/mol. Its IUPAC name is methyl 3-chloro-4-[[2-[[cyclohexyl(methyl)amino]methyl]phenyl]sulfamoyl]benzoate.
| Compound Name | methyl 3-chloro-4-[[2-[[cyclohexyl(methyl)amino]methyl]phenyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 52857530 |
| Molecular Formula | C22H27ClN2O4S |
| Molecular Weight | 450.99 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | methyl 3-chloro-4-[[2-[[cyclohexyl(methyl)amino]methyl]phenyl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)Nc2ccccc2CN(C)C2CCCCC2)c(Cl)c1 |
| InChI | InChI=1S/C22H27ClN2O4S/c1-25(18-9-4-3-5-10-18)15-17-8-6-7-11-20(17)24-30(27,28)21-13-12-16(14-19(21)23)22(26)29-2/h6-8,11-14,18,24H,3-5,9-10,15H2,1-2H3 |
| InChIKey | BZVCIRBLTKNYNE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.99 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |