C22H30N2O3S — CID 36575306
N-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]-4-ethoxybenzenesulfonamide (PubChem CID 36575306) has the molecular formula C22H30N2O3S and a molecular weight of 402.56 g/mol. Its IUPAC name is N-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]-4-ethoxybenzenesulfonamide.
| Compound Name | N-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]-4-ethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 36575306 |
| Molecular Formula | C22H30N2O3S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | N-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]-4-ethoxybenzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2ccccc2CN(C)C2CCCCC2)cc1 |
| InChI | InChI=1S/C22H30N2O3S/c1-3-27-20-13-15-21(16-14-20)28(25,26)23-22-12-8-7-9-18(22)17-24(2)19-10-5-4-6-11-19/h7-9,12-16,19,23H,3-6,10-11,17H2,1-2H3 |
| InChIKey | AGDCJCPGTOMUFN-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |