C24H28ClN2O2S- — CID 53350941
N-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]naphthalene-2-sulfonamide chloride (PubChem CID 53350941) has the molecular formula C24H28ClN2O2S- and a molecular weight of 444.02 g/mol. Its IUPAC name is N-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]naphthalene-2-sulfonamide chloride.
| Compound Name | N-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]naphthalene-2-sulfonamide chloride |
|---|---|
| PubChem CID | 53350941 |
| Molecular Formula | C24H28ClN2O2S- |
| Molecular Weight | 444.02 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | N-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]naphthalene-2-sulfonamide chloride |
| SMILES | CN(Cc1ccccc1NS(=O)(=O)c1ccc2ccccc2c1)C1CCCCC1.[Cl-] |
| InChI | InChI=1S/C24H28N2O2S.ClH/c1-26(22-12-3-2-4-13-22)18-21-11-7-8-14-24(21)25-29(27,28)23-16-15-19-9-5-6-10-20(19)17-23;/h5-11,14-17,22,25H,2-4,12-13,18H2,1H3;1H/p-1 |
| InChIKey | CDVYJHUEPSRWBB-UHFFFAOYSA-M |
| XLogP | 2.41 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.02 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |