C7H9F2N — CID 156740840
N-ethenyl-1,1-difluoro-3-methylbut-3-en-2-imine (PubChem CID 156740840) has the molecular formula C7H9F2N and a molecular weight of 145.15 g/mol. Its IUPAC name is N-ethenyl-1,1-difluoro-3-methylbut-3-en-2-imine.
| Compound Name | N-ethenyl-1,1-difluoro-3-methylbut-3-en-2-imine |
|---|---|
| PubChem CID | 156740840 |
| Molecular Formula | C7H9F2N |
| Molecular Weight | 145.15 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | N-ethenyl-1,1-difluoro-3-methylbut-3-en-2-imine |
| SMILES | C=C/N=C(\C(=C)C)C(F)F |
| InChI | InChI=1S/C7H9F2N/c1-4-10-6(5(2)3)7(8)9/h4,7H,1-2H2,3H3/b10-6+ |
| InChIKey | RCFGDDDGSZZFSQ-UXBLZVDNSA-N |
| XLogP | 2.41 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.15 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|