C10H13NO4 — CID 156741249
methyl (2Z)-2-but-1-en-2-yl-3-nitropenta-2,4-dienoate (PubChem CID 156741249) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is methyl (2Z)-2-but-1-en-2-yl-3-nitropenta-2,4-dienoate.
| Compound Name | methyl (2Z)-2-but-1-en-2-yl-3-nitropenta-2,4-dienoate |
|---|---|
| PubChem CID | 156741249 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | methyl (2Z)-2-but-1-en-2-yl-3-nitropenta-2,4-dienoate |
| SMILES | C=C/C(=C(\C(=C)CC)C(=O)OC)[N+](=O)[O-] |
| InChI | InChI=1S/C10H13NO4/c1-5-7(3)9(10(12)15-4)8(6-2)11(13)14/h6H,2-3,5H2,1,4H3/b9-8- |
| InChIKey | YKPPLQLDNLQJPL-HJWRWDBZSA-N |
| XLogP | 1.84 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|