C16H20N2O3 — CID 156741275
N-[6-methoxy-5-[(E)-2-[(3S)-oxan-3-yl]ethenyl]-3-pyridinyl]prop-2-enamide (PubChem CID 156741275) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is N-[6-methoxy-5-[(E)-2-[(3S)-oxan-3-yl]ethenyl]-3-pyridinyl]prop-2-enamide.
| Compound Name | N-[6-methoxy-5-[(E)-2-[(3S)-oxan-3-yl]ethenyl]-3-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 156741275 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | N-[6-methoxy-5-[(E)-2-[(3S)-oxan-3-yl]ethenyl]-3-pyridinyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cnc(OC)c(/C=C/[C@@H]2CCCOC2)c1 |
| InChI | InChI=1S/C16H20N2O3/c1-3-15(19)18-14-9-13(16(20-2)17-10-14)7-6-12-5-4-8-21-11-12/h3,6-7,9-10,12H,1,4-5,8,11H2,2H3,(H,18,19)/b7-6+/t12-/m0/s1 |
| InChIKey | VDSFSDKAQDHCBS-SYTKJHMZSA-N |
| XLogP | 2.65 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|