C19H23F3N2O3 — CID 156741178
N-[2-(hydroxymethyl)-6-methoxy-5-[2-[4-(trifluoromethyl)cyclohexyl]ethenyl]-3-pyridinyl]prop-2-enamide (PubChem CID 156741178) has the molecular formula C19H23F3N2O3 and a molecular weight of 384.40 g/mol. Its IUPAC name is N-[2-(hydroxymethyl)-6-methoxy-5-[2-[4-(trifluoromethyl)cyclohexyl]ethenyl]-3-pyridinyl]prop-2-enamide.
| Compound Name | N-[2-(hydroxymethyl)-6-methoxy-5-[2-[4-(trifluoromethyl)cyclohexyl]ethenyl]-3-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 156741178 |
| Molecular Formula | C19H23F3N2O3 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | N-[2-(hydroxymethyl)-6-methoxy-5-[2-[4-(trifluoromethyl)cyclohexyl]ethenyl]-3-pyridinyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(C=CC2CCC(C(F)(F)F)CC2)c(OC)nc1CO |
| InChI | InChI=1S/C19H23F3N2O3/c1-3-17(26)23-15-10-13(18(27-2)24-16(15)11-25)7-4-12-5-8-14(9-6-12)19(20,21)22/h3-4,7,10,12,14,25H,1,5-6,8-9,11H2,2H3,(H,23,26) |
| InChIKey | MQXFRJWCEAXVEJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|