C21H24F2N2O — CID 170318362
N-[3-[2-(4,4-difluorocyclohexyl)ethenyl]-1-ethylindol-5-yl]prop-2-enamide (PubChem CID 170318362) has the molecular formula C21H24F2N2O and a molecular weight of 358.43 g/mol. Its IUPAC name is N-[3-[2-(4,4-difluorocyclohexyl)ethenyl]-1-ethylindol-5-yl]prop-2-enamide.
| Compound Name | N-[3-[2-(4,4-difluorocyclohexyl)ethenyl]-1-ethylindol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 170318362 |
| Molecular Formula | C21H24F2N2O |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | N-[3-[2-(4,4-difluorocyclohexyl)ethenyl]-1-ethylindol-5-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc2c(c1)c(C=CC1CCC(F)(F)CC1)cn2CC |
| InChI | InChI=1S/C21H24F2N2O/c1-3-20(26)24-17-7-8-19-18(13-17)16(14-25(19)4-2)6-5-15-9-11-21(22,23)12-10-15/h3,5-8,13-15H,1,4,9-12H2,2H3,(H,24,26) |
| InChIKey | BCXIEOGHZOASRJ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|