C20H22F2N2O — CID 170318329
N-[3-[2-(4,4-difluorocyclohexyl)ethenyl]-1-methylindol-6-yl]prop-2-enamide (PubChem CID 170318329) has the molecular formula C20H22F2N2O and a molecular weight of 344.41 g/mol. Its IUPAC name is N-[3-[2-(4,4-difluorocyclohexyl)ethenyl]-1-methylindol-6-yl]prop-2-enamide.
| Compound Name | N-[3-[2-(4,4-difluorocyclohexyl)ethenyl]-1-methylindol-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 170318329 |
| Molecular Formula | C20H22F2N2O |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | N-[3-[2-(4,4-difluorocyclohexyl)ethenyl]-1-methylindol-6-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc2c(C=CC3CCC(F)(F)CC3)cn(C)c2c1 |
| InChI | InChI=1S/C20H22F2N2O/c1-3-19(25)23-16-6-7-17-15(13-24(2)18(17)12-16)5-4-14-8-10-20(21,22)11-9-14/h3-7,12-14H,1,8-11H2,2H3,(H,23,25) |
| InChIKey | OKQUBOQXVFPBSO-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|