C19H23F3N2O2 — CID 156741288
N-[5-[(E)-2-cyclohexylethenyl]-6-methoxy-3-pyridinyl]but-2-ynamide;fluoroform (PubChem CID 156741288) has the molecular formula C19H23F3N2O2 and a molecular weight of 368.40 g/mol. Its IUPAC name is N-[5-[(E)-2-cyclohexylethenyl]-6-methoxy-3-pyridinyl]but-2-ynamide;fluoroform.
| Compound Name | N-[5-[(E)-2-cyclohexylethenyl]-6-methoxy-3-pyridinyl]but-2-ynamide;fluoroform |
|---|---|
| PubChem CID | 156741288 |
| Molecular Formula | C19H23F3N2O2 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | N-[5-[(E)-2-cyclohexylethenyl]-6-methoxy-3-pyridinyl]but-2-ynamide;fluoroform |
| SMILES | CC#CC(=O)Nc1cnc(OC)c(/C=C/C2CCCCC2)c1.FC(F)F |
| InChI | InChI=1S/C18H22N2O2.CHF3/c1-3-7-17(21)20-16-12-15(18(22-2)19-13-16)11-10-14-8-5-4-6-9-14;2-1(3)4/h10-14H,4-6,8-9H2,1-2H3,(H,20,21);1H/b11-10+; |
| InChIKey | BDOXNEOFZSHGQA-ASTDGNLGSA-N |
| XLogP | 4.82 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|