C22H45NO — CID 156741428
5-ethenyl-3-methoxy-N,N,5-tripropyldecan-1-amine (PubChem CID 156741428) has the molecular formula C22H45NO and a molecular weight of 339.61 g/mol. Its IUPAC name is 5-ethenyl-3-methoxy-N,N,5-tripropyldecan-1-amine.
| Compound Name | 5-ethenyl-3-methoxy-N,N,5-tripropyldecan-1-amine |
|---|---|
| PubChem CID | 156741428 |
| Molecular Formula | C22H45NO |
| Molecular Weight | 339.61 g/mol |
| Exact Mass | 339.35 |
| IUPAC Name | 5-ethenyl-3-methoxy-N,N,5-tripropyldecan-1-amine |
| SMILES | C=CC(CCC)(CCCCC)CC(CCN(CCC)CCC)OC |
| InChI | InChI=1S/C22H45NO/c1-7-12-13-16-22(11-5,15-8-2)20-21(24-6)14-19-23(17-9-3)18-10-4/h11,21H,5,7-10,12-20H2,1-4,6H3 |
| InChIKey | HPMNBDNETQAPBL-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.61 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|