C29H39FN2O3 — CID 156741475
(3R)-3-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-8-[(E)-2-oxohept-5-enylidene]-2-oxaspiro[4.6]undecan-1-one (PubChem CID 156741475) has the molecular formula C29H39FN2O3 and a molecular weight of 482.64 g/mol. Its IUPAC name is (3R)-3-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-8-[(E)-2-oxohept-5-enylidene]-2-oxaspiro[4.6]undecan-1-one.
| Compound Name | (3R)-3-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-8-[(E)-2-oxohept-5-enylidene]-2-oxaspiro[4.6]undecan-1-one |
|---|---|
| PubChem CID | 156741475 |
| Molecular Formula | C29H39FN2O3 |
| Molecular Weight | 482.64 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | (3R)-3-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-8-[(E)-2-oxohept-5-enylidene]-2-oxaspiro[4.6]undecan-1-one |
| SMILES | C/C=C/CCC(=O)C=C1CCCC2(CC1)C[C@H](CCN1CCN(c3ccc(F)cc3)CC1)OC2=O |
| InChI | InChI=1S/C29H39FN2O3/c1-2-3-4-7-26(33)21-23-6-5-14-29(15-12-23)22-27(35-28(29)34)13-16-31-17-19-32(20-18-31)25-10-8-24(30)9-11-25/h2-3,8-11,21,27H,4-7,12-20,22H2,1H3/b3-2+,23-21?/t27-,29?/m0/s1 |
| InChIKey | PGLPPSOOYKXITF-PJRYBEMNSA-N |
| XLogP | 5.46 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.64 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|