C11H18N3O4S+ — CID 156742380
3-(piperidin-1-ium-4-ylmethyl)-1-sulfamoylpyrrole-2-carboxylic acid (PubChem CID 156742380) has the molecular formula C11H18N3O4S+ and a molecular weight of 288.35 g/mol. Its IUPAC name is 3-(piperidin-1-ium-4-ylmethyl)-1-sulfamoylpyrrole-2-carboxylic acid.
| Compound Name | 3-(piperidin-1-ium-4-ylmethyl)-1-sulfamoylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 156742380 |
| Molecular Formula | C11H18N3O4S+ |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 3-(piperidin-1-ium-4-ylmethyl)-1-sulfamoylpyrrole-2-carboxylic acid |
| SMILES | NS(=O)(=O)n1ccc(CC2CC[NH2+]CC2)c1C(=O)O |
| InChI | InChI=1S/C11H17N3O4S/c12-19(17,18)14-6-3-9(10(14)11(15)16)7-8-1-4-13-5-2-8/h3,6,8,13H,1-2,4-5,7H2,(H,15,16)(H2,12,17,18)/p+1 |
| InChIKey | XVOGNVOZYWJDEI-UHFFFAOYSA-O |
| XLogP | -1.25 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |