About (2Z)-1-methyl-2-(3-methylbut-3-en-2-ylidene)-1,3-diazinane;molecular hydrogen
(2Z)-1-methyl-2-(3-methylbut-3-en-2-ylidene)-1,3-diazinane;molecular hydrogen (PubChem CID 156744032) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is (2Z)-1-methyl-2-(3-methylbut-3-en-2-ylidene)-1,3-diazinane;molecular hydrogen.
Molecular Properties
| Compound Name | (2Z)-1-methyl-2-(3-methylbut-3-en-2-ylidene)-1,3-diazinane;molecular hydrogen |
| PubChem CID | 156744032 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | (2Z)-1-methyl-2-(3-methylbut-3-en-2-ylidene)-1,3-diazinane;molecular hydrogen |
| SMILES | C=C(C)/C(C)=C1/NCCCN1C.[H][H] |
| InChI | InChI=1S/C10H18N2.H2/c1-8(2)9(3)10-11-6-5-7-12(10)4;/h11H,1,5-7H2,2-4H3;1H/b10-9-; |
| InChIKey | YSODXXDGLSUNDM-KVVVOXFISA-N |
| XLogP | 1.97 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2Z)-1-methyl-2-(3-methylbut-3-en-2-ylidene)-1,3-diazinane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-1-methyl-2-(3-methylbut-3-en-2-ylidene)-1,3-diazinane;molecular hydrogen?
The IUPAC name of (2Z)-1-methyl-2-(3-methylbut-3-en-2-ylidene)-1,3-diazinane;molecular hydrogen (CID 156744032) is (2Z)-1-methyl-2-(3-methylbut-3-en-2-ylidene)-1,3-diazinane;molecular hydrogen.
What is the SMILES notation for (2Z)-1-methyl-2-(3-methylbut-3-en-2-ylidene)-1,3-diazinane;molecular hydrogen?
The canonical SMILES for (2Z)-1-methyl-2-(3-methylbut-3-en-2-ylidene)-1,3-diazinane;molecular hydrogen is C=C(C)/C(C)=C1/NCCCN1C.[H][H].
What is the InChIKey of (2Z)-1-methyl-2-(3-methylbut-3-en-2-ylidene)-1,3-diazinane;molecular hydrogen?
The InChIKey is YSODXXDGLSUNDM-KVVVOXFISA-N. The full InChI is InChI=1S/C10H18N2.H2/c1-8(2)9(3)10-11-6-5-7-12(10)4;/h11H,1,5-7H2,2-4H3;1H/b10-9-;.
What are the key properties of (2Z)-1-methyl-2-(3-methylbut-3-en-2-ylidene)-1,3-diazinane;molecular hydrogen?
(2Z)-1-methyl-2-(3-methylbut-3-en-2-ylidene)-1,3-diazinane;molecular hydrogen has a molecular weight of 168.28 g/mol, XLogP of 1.97, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-1-methyl-2-(3-methylbut-3-en-2-ylidene)-1,3-diazinane;molecular hydrogen is sourced from PubChem (CID 156744032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).