C8H17N3 — CID 91041133
N,N,4-trimethyl-5-methylidene-1,3-diazinan-2-amine (PubChem CID 91041133) has the molecular formula C8H17N3 and a molecular weight of 155.24 g/mol. Its IUPAC name is N,N,4-trimethyl-5-methylidene-1,3-diazinan-2-amine.
| Compound Name | N,N,4-trimethyl-5-methylidene-1,3-diazinan-2-amine |
|---|---|
| PubChem CID | 91041133 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | N,N,4-trimethyl-5-methylidene-1,3-diazinan-2-amine |
| SMILES | C=C1CNC(N(C)C)NC1C |
| InChI | InChI=1S/C8H17N3/c1-6-5-9-8(11(3)4)10-7(6)2/h7-10H,1,5H2,2-4H3 |
| InChIKey | APNZHWCHFGTVEI-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|