C7H14N2 — CID 91138135
4,6-dimethyl-5-methylidene-1,3-diazinane (PubChem CID 91138135) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is 4,6-dimethyl-5-methylidene-1,3-diazinane.
| Compound Name | 4,6-dimethyl-5-methylidene-1,3-diazinane |
|---|---|
| PubChem CID | 91138135 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | 4,6-dimethyl-5-methylidene-1,3-diazinane |
| SMILES | C=C1C(C)NCNC1C |
| InChI | InChI=1S/C7H14N2/c1-5-6(2)8-4-9-7(5)3/h6-9H,1,4H2,2-3H3 |
| InChIKey | MVCFYWPYLOYTTI-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|