About 4-methyl-5-methylidene-1,3-diazinan-2-amine
4-methyl-5-methylidene-1,3-diazinan-2-amine (PubChem CID 123831195) has the molecular formula C6H13N3
and a molecular weight of 127.19 g/mol. Its IUPAC name is 4-methyl-5-methylidene-1,3-diazinan-2-amine.
Molecular Properties
| Compound Name | 4-methyl-5-methylidene-1,3-diazinan-2-amine |
| PubChem CID | 123831195 |
| Molecular Formula | C6H13N3 |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.11 |
| IUPAC Name | 4-methyl-5-methylidene-1,3-diazinan-2-amine |
| SMILES | C=C1CNC(N)NC1C |
| InChI | InChI=1S/C6H13N3/c1-4-3-8-6(7)9-5(4)2/h5-6,8-9H,1,3,7H2,2H3 |
| InChIKey | YOOXSFBOSXRHLJ-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-5-methylidene-1,3-diazinan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-5-methylidene-1,3-diazinan-2-amine?
The IUPAC name of 4-methyl-5-methylidene-1,3-diazinan-2-amine (CID 123831195) is 4-methyl-5-methylidene-1,3-diazinan-2-amine.
What is the SMILES notation for 4-methyl-5-methylidene-1,3-diazinan-2-amine?
The canonical SMILES for 4-methyl-5-methylidene-1,3-diazinan-2-amine is C=C1CNC(N)NC1C.
What is the InChIKey of 4-methyl-5-methylidene-1,3-diazinan-2-amine?
The InChIKey is YOOXSFBOSXRHLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3/c1-4-3-8-6(7)9-5(4)2/h5-6,8-9H,1,3,7H2,2H3.
What are the key properties of 4-methyl-5-methylidene-1,3-diazinan-2-amine?
4-methyl-5-methylidene-1,3-diazinan-2-amine has a molecular weight of 127.19 g/mol, XLogP of -0.63, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-5-methylidene-1,3-diazinan-2-amine is sourced from PubChem (CID 123831195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).