C10H20N2 — CID 142845495
4,5-bis(ethenyl)-1,3-diazinane;ethane (PubChem CID 142845495) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is 4,5-bis(ethenyl)-1,3-diazinane;ethane.
| Compound Name | 4,5-bis(ethenyl)-1,3-diazinane;ethane |
|---|---|
| PubChem CID | 142845495 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 4,5-bis(ethenyl)-1,3-diazinane;ethane |
| SMILES | C=CC1CNCNC1C=C.CC |
| InChI | InChI=1S/C8H14N2.C2H6/c1-3-7-5-9-6-10-8(7)4-2;1-2/h3-4,7-10H,1-2,5-6H2;1-2H3 |
| InChIKey | NMBDYWSQXQUWNC-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|