C14H20FN5O2 — CID 156747449
2-amino-7-ethyl-9-(4-fluoro-5-propyloxolan-2-yl)purin-8-one (PubChem CID 156747449) has the molecular formula C14H20FN5O2 and a molecular weight of 309.35 g/mol. Its IUPAC name is 2-amino-7-ethyl-9-(4-fluoro-5-propyloxolan-2-yl)purin-8-one.
| Compound Name | 2-amino-7-ethyl-9-(4-fluoro-5-propyloxolan-2-yl)purin-8-one |
|---|---|
| PubChem CID | 156747449 |
| Molecular Formula | C14H20FN5O2 |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 2-amino-7-ethyl-9-(4-fluoro-5-propyloxolan-2-yl)purin-8-one |
| SMILES | CCCC1OC(n2c(=O)n(CC)c3cnc(N)nc32)CC1F |
| InChI | InChI=1S/C14H20FN5O2/c1-3-5-10-8(15)6-11(22-10)20-12-9(7-17-13(16)18-12)19(4-2)14(20)21/h7-8,10-11H,3-6H2,1-2H3,(H2,16,17,18) |
| InChIKey | FUTYTGIEPBMJBM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |