C25H24Cl2N2O3 — CID 156753692
benzyl (2S)-2-[(2,6-dichloro-4-phenylbenzoyl)amino]-3-(ethylamino)propanoate (PubChem CID 156753692) has the molecular formula C25H24Cl2N2O3 and a molecular weight of 471.38 g/mol. Its IUPAC name is benzyl (2S)-2-[(2,6-dichloro-4-phenylbenzoyl)amino]-3-(ethylamino)propanoate.
| Compound Name | benzyl (2S)-2-[(2,6-dichloro-4-phenylbenzoyl)amino]-3-(ethylamino)propanoate |
|---|---|
| PubChem CID | 156753692 |
| Molecular Formula | C25H24Cl2N2O3 |
| Molecular Weight | 471.38 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | benzyl (2S)-2-[(2,6-dichloro-4-phenylbenzoyl)amino]-3-(ethylamino)propanoate |
| SMILES | CCNC[C@H](NC(=O)c1c(Cl)cc(-c2ccccc2)cc1Cl)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H24Cl2N2O3/c1-2-28-15-22(25(31)32-16-17-9-5-3-6-10-17)29-24(30)23-20(26)13-19(14-21(23)27)18-11-7-4-8-12-18/h3-14,22,28H,2,15-16H2,1H3,(H,29,30)/t22-/m0/s1 |
| InChIKey | AUQFHJKOALUJDE-QFIPXVFZSA-N |
| XLogP | 5.11 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.38 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |