About ethyl (2S)-6-amino-2-[(2,6-dichloro-4-phenylbenzoyl)amino]-5-oxohexanoate
ethyl (2S)-6-amino-2-[(2,6-dichloro-4-phenylbenzoyl)amino]-5-oxohexanoate (PubChem CID 158525492) has the molecular formula C21H22Cl2N2O4
and a molecular weight of 437.32 g/mol. Its IUPAC name is ethyl (2S)-6-amino-2-[(2,6-dichloro-4-phenylbenzoyl)amino]-5-oxohexanoate.
Molecular Properties
| Compound Name | ethyl (2S)-6-amino-2-[(2,6-dichloro-4-phenylbenzoyl)amino]-5-oxohexanoate |
| PubChem CID | 158525492 |
| Molecular Formula | C21H22Cl2N2O4 |
| Molecular Weight | 437.32 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | ethyl (2S)-6-amino-2-[(2,6-dichloro-4-phenylbenzoyl)amino]-5-oxohexanoate |
| SMILES | CCOC(=O)[C@H](CCC(=O)CN)NC(=O)c1c(Cl)cc(-c2ccccc2)cc1Cl |
| InChI | InChI=1S/C21H22Cl2N2O4/c1-2-29-21(28)18(9-8-15(26)12-24)25-20(27)19-16(22)10-14(11-17(19)23)13-6-4-3-5-7-13/h3-7,10-11,18H,2,8-9,12,24H2,1H3,(H,25,27)/t18-/m0/s1 |
| InChIKey | GRLMLDKDTHPJRL-SFHVURJKSA-N |
| XLogP | 3.63 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl (2S)-6-amino-2-[(2,6-dichloro-4-phenylbenzoyl)amino]-5-oxohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2S)-6-amino-2-[(2,6-dichloro-4-phenylbenzoyl)amino]-5-oxohexanoate?
The IUPAC name of ethyl (2S)-6-amino-2-[(2,6-dichloro-4-phenylbenzoyl)amino]-5-oxohexanoate (CID 158525492) is ethyl (2S)-6-amino-2-[(2,6-dichloro-4-phenylbenzoyl)amino]-5-oxohexanoate.
What is the SMILES notation for ethyl (2S)-6-amino-2-[(2,6-dichloro-4-phenylbenzoyl)amino]-5-oxohexanoate?
The canonical SMILES for ethyl (2S)-6-amino-2-[(2,6-dichloro-4-phenylbenzoyl)amino]-5-oxohexanoate is CCOC(=O)[C@H](CCC(=O)CN)NC(=O)c1c(Cl)cc(-c2ccccc2)cc1Cl.
What is the InChIKey of ethyl (2S)-6-amino-2-[(2,6-dichloro-4-phenylbenzoyl)amino]-5-oxohexanoate?
The InChIKey is GRLMLDKDTHPJRL-SFHVURJKSA-N. The full InChI is InChI=1S/C21H22Cl2N2O4/c1-2-29-21(28)18(9-8-15(26)12-24)25-20(27)19-16(22)10-14(11-17(19)23)13-6-4-3-5-7-13/h3-7,10-11,18H,2,8-9,12,24H2,1H3,(H,25,27)/t18-/m0/s1.
What are the key properties of ethyl (2S)-6-amino-2-[(2,6-dichloro-4-phenylbenzoyl)amino]-5-oxohexanoate?
ethyl (2S)-6-amino-2-[(2,6-dichloro-4-phenylbenzoyl)amino]-5-oxohexanoate has a molecular weight of 437.32 g/mol, XLogP of 3.63, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2S)-6-amino-2-[(2,6-dichloro-4-phenylbenzoyl)amino]-5-oxohexanoate is sourced from PubChem (CID 158525492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).