C11H18O4 — CID 156755188
(3S,4S,5S)-4-hydroxy-3-(1-hydroxyhex-5-enyl)-5-methyloxolan-2-one (PubChem CID 156755188) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is (3S,4S,5S)-4-hydroxy-3-(1-hydroxyhex-5-enyl)-5-methyloxolan-2-one.
| Compound Name | (3S,4S,5S)-4-hydroxy-3-(1-hydroxyhex-5-enyl)-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 156755188 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | (3S,4S,5S)-4-hydroxy-3-(1-hydroxyhex-5-enyl)-5-methyloxolan-2-one |
| SMILES | C=CCCCC(O)[C@@H]1C(=O)O[C@@H](C)[C@H]1O |
| InChI | InChI=1S/C11H18O4/c1-3-4-5-6-8(12)9-10(13)7(2)15-11(9)14/h3,7-10,12-13H,1,4-6H2,2H3/t7-,8?,9-,10+/m0/s1 |
| InChIKey | LWPJMMDUMFCGBY-BFARCFIYSA-N |
| XLogP | 0.63 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|