C13H22O4 — CID 156755190
(3S,4S,5S)-4-hydroxy-3-(1-hydroxyoct-7-enyl)-5-methyloxolan-2-one (PubChem CID 156755190) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is (3S,4S,5S)-4-hydroxy-3-(1-hydroxyoct-7-enyl)-5-methyloxolan-2-one.
| Compound Name | (3S,4S,5S)-4-hydroxy-3-(1-hydroxyoct-7-enyl)-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 156755190 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (3S,4S,5S)-4-hydroxy-3-(1-hydroxyoct-7-enyl)-5-methyloxolan-2-one |
| SMILES | C=CCCCCCC(O)[C@@H]1C(=O)O[C@@H](C)[C@H]1O |
| InChI | InChI=1S/C13H22O4/c1-3-4-5-6-7-8-10(14)11-12(15)9(2)17-13(11)16/h3,9-12,14-15H,1,4-8H2,2H3/t9-,10?,11-,12+/m0/s1 |
| InChIKey | CBIAVGWWFZWTPI-YEJSDXFRSA-N |
| XLogP | 1.41 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|