C15H10N2O6 — CID 156760820
2-(3-carboxy-2,5-dihydroxyphenyl)-3H-benzimidazole-5-carboxylic acid (PubChem CID 156760820) has the molecular formula C15H10N2O6 and a molecular weight of 314.25 g/mol. Its IUPAC name is 2-(3-carboxy-2,5-dihydroxyphenyl)-3H-benzimidazole-5-carboxylic acid.
| Compound Name | 2-(3-carboxy-2,5-dihydroxyphenyl)-3H-benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 156760820 |
| Molecular Formula | C15H10N2O6 |
| Molecular Weight | 314.25 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 2-(3-carboxy-2,5-dihydroxyphenyl)-3H-benzimidazole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2nc(-c3cc(O)cc(C(=O)O)c3O)[nH]c2c1 |
| InChI | InChI=1S/C15H10N2O6/c18-7-4-8(12(19)9(5-7)15(22)23)13-16-10-2-1-6(14(20)21)3-11(10)17-13/h1-5,18-19H,(H,16,17)(H,20,21)(H,22,23) |
| InChIKey | GDEGPBRUHDLNFE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 143.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.25 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|