C13H12F8O2 — CID 156764494
1-methoxy-4-[3,3,4,4,4-pentafluoro-1-(2,2,2-trifluoroethoxy)butyl]benzene (PubChem CID 156764494) has the molecular formula C13H12F8O2 and a molecular weight of 352.22 g/mol. Its IUPAC name is 1-methoxy-4-[3,3,4,4,4-pentafluoro-1-(2,2,2-trifluoroethoxy)butyl]benzene.
| Compound Name | 1-methoxy-4-[3,3,4,4,4-pentafluoro-1-(2,2,2-trifluoroethoxy)butyl]benzene |
|---|---|
| PubChem CID | 156764494 |
| Molecular Formula | C13H12F8O2 |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 1-methoxy-4-[3,3,4,4,4-pentafluoro-1-(2,2,2-trifluoroethoxy)butyl]benzene |
| SMILES | COc1ccc(C(CC(F)(F)C(F)(F)F)OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H12F8O2/c1-22-9-4-2-8(3-5-9)10(23-7-12(16,17)18)6-11(14,15)13(19,20)21/h2-5,10H,6-7H2,1H3 |
| InChIKey | RIDZCDDHRIQOBL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|