C14H13F9O — CID 156765042
(4,4,5,5,6,6,7,7,7-nonafluoro-2-methoxyheptan-2-yl)benzene (PubChem CID 156765042) has the molecular formula C14H13F9O and a molecular weight of 368.24 g/mol. Its IUPAC name is (4,4,5,5,6,6,7,7,7-nonafluoro-2-methoxyheptan-2-yl)benzene.
| Compound Name | (4,4,5,5,6,6,7,7,7-nonafluoro-2-methoxyheptan-2-yl)benzene |
|---|---|
| PubChem CID | 156765042 |
| Molecular Formula | C14H13F9O |
| Molecular Weight | 368.24 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | (4,4,5,5,6,6,7,7,7-nonafluoro-2-methoxyheptan-2-yl)benzene |
| SMILES | COC(C)(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C14H13F9O/c1-10(24-2,9-6-4-3-5-7-9)8-11(15,16)12(17,18)13(19,20)14(21,22)23/h3-7H,8H2,1-2H3 |
| InChIKey | VMNUASHTWDTHIA-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.24 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|