C15H21F3O2 — CID 156765584
1-butoxy-2-(4,4,4-trifluoro-2-methoxybutan-2-yl)benzene (PubChem CID 156765584) has the molecular formula C15H21F3O2 and a molecular weight of 290.33 g/mol. Its IUPAC name is 1-butoxy-2-(4,4,4-trifluoro-2-methoxybutan-2-yl)benzene.
| Compound Name | 1-butoxy-2-(4,4,4-trifluoro-2-methoxybutan-2-yl)benzene |
|---|---|
| PubChem CID | 156765584 |
| Molecular Formula | C15H21F3O2 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 1-butoxy-2-(4,4,4-trifluoro-2-methoxybutan-2-yl)benzene |
| SMILES | CCCCOc1ccccc1C(C)(CC(F)(F)F)OC |
| InChI | InChI=1S/C15H21F3O2/c1-4-5-10-20-13-9-7-6-8-12(13)14(2,19-3)11-15(16,17)18/h6-9H,4-5,10-11H2,1-3H3 |
| InChIKey | VAFOENJFZQRESH-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|