C15H21NO3 — CID 156766348
2-(2,2-diethoxyethyl)-5-methyl-3H-isoindol-1-one (PubChem CID 156766348) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 2-(2,2-diethoxyethyl)-5-methyl-3H-isoindol-1-one.
| Compound Name | 2-(2,2-diethoxyethyl)-5-methyl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 156766348 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 2-(2,2-diethoxyethyl)-5-methyl-3H-isoindol-1-one |
| SMILES | CCOC(CN1Cc2cc(C)ccc2C1=O)OCC |
| InChI | InChI=1S/C15H21NO3/c1-4-18-14(19-5-2)10-16-9-12-8-11(3)6-7-13(12)15(16)17/h6-8,14H,4-5,9-10H2,1-3H3 |
| InChIKey | XEBRWLIYSIWGKQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|