C12H10N2 — CID 156768233
spiro[1H-pyridine-2,2'-indole] (PubChem CID 156768233) has the molecular formula C12H10N2 and a molecular weight of 182.23 g/mol. Its IUPAC name is spiro[1H-pyridine-2,2'-indole].
| Compound Name | spiro[1H-pyridine-2,2'-indole] |
|---|---|
| PubChem CID | 156768233 |
| Molecular Formula | C12H10N2 |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | spiro[1H-pyridine-2,2'-indole] |
| SMILES | C1=CNC2(C=C1)C=c1ccccc1=N2 |
| InChI | InChI=1S/C12H10N2/c1-2-6-11-10(5-1)9-12(14-11)7-3-4-8-13-12/h1-9,13H |
| InChIKey | UTNRCAULJDUOPQ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |