About methyl 2-aminoacetate;2-phenyl-1H-pyridine-2-carboxamide
methyl 2-aminoacetate;2-phenyl-1H-pyridine-2-carboxamide (PubChem CID 174829110) has the molecular formula C15H19N3O3
and a molecular weight of 289.34 g/mol. Its IUPAC name is methyl 2-aminoacetate;2-phenyl-1H-pyridine-2-carboxamide.
Molecular Properties
| Compound Name | methyl 2-aminoacetate;2-phenyl-1H-pyridine-2-carboxamide |
| PubChem CID | 174829110 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | methyl 2-aminoacetate;2-phenyl-1H-pyridine-2-carboxamide |
| SMILES | COC(=O)CN.NC(=O)C1(c2ccccc2)C=CC=CN1 |
| InChI | InChI=1S/C12H12N2O.C3H7NO2/c13-11(15)12(8-4-5-9-14-12)10-6-2-1-3-7-10;1-6-3(5)2-4/h1-9,14H,(H2,13,15);2,4H2,1H3 |
| InChIKey | NEDPDFDQBFWXDA-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-aminoacetate;2-phenyl-1H-pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-aminoacetate;2-phenyl-1H-pyridine-2-carboxamide?
The IUPAC name of methyl 2-aminoacetate;2-phenyl-1H-pyridine-2-carboxamide (CID 174829110) is methyl 2-aminoacetate;2-phenyl-1H-pyridine-2-carboxamide.
What is the SMILES notation for methyl 2-aminoacetate;2-phenyl-1H-pyridine-2-carboxamide?
The canonical SMILES for methyl 2-aminoacetate;2-phenyl-1H-pyridine-2-carboxamide is COC(=O)CN.NC(=O)C1(c2ccccc2)C=CC=CN1.
What is the InChIKey of methyl 2-aminoacetate;2-phenyl-1H-pyridine-2-carboxamide?
The InChIKey is NEDPDFDQBFWXDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O.C3H7NO2/c13-11(15)12(8-4-5-9-14-12)10-6-2-1-3-7-10;1-6-3(5)2-4/h1-9,14H,(H2,13,15);2,4H2,1H3.
What are the key properties of methyl 2-aminoacetate;2-phenyl-1H-pyridine-2-carboxamide?
methyl 2-aminoacetate;2-phenyl-1H-pyridine-2-carboxamide has a molecular weight of 289.34 g/mol, XLogP of 0.16, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-aminoacetate;2-phenyl-1H-pyridine-2-carboxamide is sourced from PubChem (CID 174829110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).