methyl 2-aminoacetate;2-phenyl-1H-pyridine-2-carboxamide

C15H19N3O3 — CID 174829110

IUPACmethyl 2-aminoacetate;2-phenyl-1H-pyridine-2-carboxamide
SMILESCOC(=O)CN.NC(=O)C1(c2ccccc2)C=CC=CN1
InChIInChI=1S/C12H12N2O.C3H7NO2/c13-11(15)12(8-4-5-9-14-12)10-6-2-1-3-7-10;1-6-3(5)2-4/h1-9,14H,(H2,13,15);2,4H2,1H3
InChIKeyNEDPDFDQBFWXDA-UHFFFAOYSA-N
MW289.34 g/mol
LogP0.16
Rot. Bonds3

About methyl 2-aminoacetate;2-phenyl-1H-pyridine-2-carboxamide

methyl 2-aminoacetate;2-phenyl-1H-pyridine-2-carboxamide (PubChem CID 174829110) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is methyl 2-aminoacetate;2-phenyl-1H-pyridine-2-carboxamide.

Molecular Properties

Compound Namemethyl 2-aminoacetate;2-phenyl-1H-pyridine-2-carboxamide
PubChem CID174829110
Molecular FormulaC15H19N3O3
Molecular Weight289.34 g/mol
Exact Mass289.14
IUPAC Namemethyl 2-aminoacetate;2-phenyl-1H-pyridine-2-carboxamide
SMILESCOC(=O)CN.NC(=O)C1(c2ccccc2)C=CC=CN1
InChIInChI=1S/C12H12N2O.C3H7NO2/c13-11(15)12(8-4-5-9-14-12)10-6-2-1-3-7-10;1-6-3(5)2-4/h1-9,14H,(H2,13,15);2,4H2,1H3
InChIKeyNEDPDFDQBFWXDA-UHFFFAOYSA-N
XLogP0.16
TPSA107.44 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500289.34
LogP ≤ 50.16
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze methyl 2-aminoacetate;2-phenyl-1H-pyridine-2-carboxamide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-aminoacetate;2-phenyl-1H-pyridine-2-carboxamide?
The IUPAC name of methyl 2-aminoacetate;2-phenyl-1H-pyridine-2-carboxamide (CID 174829110) is methyl 2-aminoacetate;2-phenyl-1H-pyridine-2-carboxamide.
What is the SMILES notation for methyl 2-aminoacetate;2-phenyl-1H-pyridine-2-carboxamide?
The canonical SMILES for methyl 2-aminoacetate;2-phenyl-1H-pyridine-2-carboxamide is COC(=O)CN.NC(=O)C1(c2ccccc2)C=CC=CN1.
What is the InChIKey of methyl 2-aminoacetate;2-phenyl-1H-pyridine-2-carboxamide?
The InChIKey is NEDPDFDQBFWXDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O.C3H7NO2/c13-11(15)12(8-4-5-9-14-12)10-6-2-1-3-7-10;1-6-3(5)2-4/h1-9,14H,(H2,13,15);2,4H2,1H3.
What are the key properties of methyl 2-aminoacetate;2-phenyl-1H-pyridine-2-carboxamide?
methyl 2-aminoacetate;2-phenyl-1H-pyridine-2-carboxamide has a molecular weight of 289.34 g/mol, XLogP of 0.16, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-aminoacetate;2-phenyl-1H-pyridine-2-carboxamide is sourced from PubChem (CID 174829110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).