C38H45N7O5 — CID 156768541
4-[2-[4-[7-[3,5-dimethoxy-N-[2-(propan-2-ylamino)ethyl]anilino]quinoxalin-2-yl]pyrazol-1-yl]ethyl]-N-(oxan-2-yloxy)benzamide (PubChem CID 156768541) has the molecular formula C38H45N7O5 and a molecular weight of 679.82 g/mol. Its IUPAC name is 4-[2-[4-[7-[3,5-dimethoxy-N-[2-(propan-2-ylamino)ethyl]anilino]quinoxalin-2-yl]pyrazol-1-yl]ethyl]-N-(oxan-2-yloxy)benzamide.
| Compound Name | 4-[2-[4-[7-[3,5-dimethoxy-N-[2-(propan-2-ylamino)ethyl]anilino]quinoxalin-2-yl]pyrazol-1-yl]ethyl]-N-(oxan-2-yloxy)benzamide |
|---|---|
| PubChem CID | 156768541 |
| Molecular Formula | C38H45N7O5 |
| Molecular Weight | 679.82 g/mol |
| Exact Mass | 679.35 |
| IUPAC Name | 4-[2-[4-[7-[3,5-dimethoxy-N-[2-(propan-2-ylamino)ethyl]anilino]quinoxalin-2-yl]pyrazol-1-yl]ethyl]-N-(oxan-2-yloxy)benzamide |
| SMILES | COc1cc(OC)cc(N(CCNC(C)C)c2ccc3ncc(-c4cnn(CCc5ccc(C(=O)NOC6CCCCO6)cc5)c4)nc3c2)c1 |
| InChI | InChI=1S/C38H45N7O5/c1-26(2)39-15-17-45(31-19-32(47-3)22-33(20-31)48-4)30-12-13-34-35(21-30)42-36(24-40-34)29-23-41-44(25-29)16-14-27-8-10-28(11-9-27)38(46)43-50-37-7-5-6-18-49-37/h8-13,19-26,37,39H,5-7,14-18H2,1-4H3,(H,43,46) |
| InChIKey | UWEFFKIKICQRAZ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 124.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.82 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|